C19H13ClN6O2S — CID 34548469
N-[2-chloro-5-[[3-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 34548469) has the molecular formula C19H13ClN6O2S and a molecular weight of 424.87 g/mol. Its IUPAC name is N-[2-chloro-5-[[3-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[[3-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 34548469 |
| Molecular Formula | C19H13ClN6O2S |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-[2-chloro-5-[[3-(tetrazol-1-yl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H13ClN6O2S/c20-15-7-6-12(9-16(15)23-19(28)17-5-2-8-29-17)18(27)22-13-3-1-4-14(10-13)26-11-21-24-25-26/h1-11H,(H,22,27)(H,23,28) |
| InChIKey | WGZOISWEAVHIIJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |