C17H12ClN3O2S — CID 27700085
N-[2-chloro-5-(pyridin-4-ylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 27700085) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is N-[2-chloro-5-(pyridin-4-ylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-(pyridin-4-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27700085 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-[2-chloro-5-(pyridin-4-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H12ClN3O2S/c18-13-4-3-11(16(22)20-12-5-7-19-8-6-12)10-14(13)21-17(23)15-2-1-9-24-15/h1-10H,(H,21,23)(H,19,20,22) |
| InChIKey | MHUQRNRWCWJLIG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |