C17H12ClN3O3S — CID 46652846
N-[2-chloro-5-[(3-hydroxy-2-pyridinyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 46652846) has the molecular formula C17H12ClN3O3S and a molecular weight of 373.82 g/mol. Its IUPAC name is N-[2-chloro-5-[(3-hydroxy-2-pyridinyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[(3-hydroxy-2-pyridinyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46652846 |
| Molecular Formula | C17H12ClN3O3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[2-chloro-5-[(3-hydroxy-2-pyridinyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ncccc1O)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H12ClN3O3S/c18-11-6-5-10(16(23)21-15-13(22)3-1-7-19-15)9-12(11)20-17(24)14-4-2-8-25-14/h1-9,22H,(H,20,24)(H,19,21,23) |
| InChIKey | JELVJMHSQSQQPH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |