C18H14ClN3O2S — CID 26591240
N-[2-chloro-5-(pyridin-3-ylmethylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 26591240) has the molecular formula C18H14ClN3O2S and a molecular weight of 371.85 g/mol. Its IUPAC name is N-[2-chloro-5-(pyridin-3-ylmethylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-(pyridin-3-ylmethylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26591240 |
| Molecular Formula | C18H14ClN3O2S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[2-chloro-5-(pyridin-3-ylmethylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H14ClN3O2S/c19-14-6-5-13(17(23)21-11-12-3-1-7-20-10-12)9-15(14)22-18(24)16-4-2-8-25-16/h1-10H,11H2,(H,21,23)(H,22,24) |
| InChIKey | GCQULXWVZPGYJF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |