C20H17ClN4O2S2 — CID 26837214
N-[5-[(benzylcarbamothioylamino)carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide (PubChem CID 26837214) has the molecular formula C20H17ClN4O2S2 and a molecular weight of 444.97 g/mol. Its IUPAC name is N-[5-[(benzylcarbamothioylamino)carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[(benzylcarbamothioylamino)carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26837214 |
| Molecular Formula | C20H17ClN4O2S2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-[5-[(benzylcarbamothioylamino)carbamoyl]-2-chlorophenyl]thiophene-2-carboxamide |
| SMILES | O=C(NNC(=S)NCc1ccccc1)c1ccc(Cl)c(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H17ClN4O2S2/c21-15-9-8-14(11-16(15)23-19(27)17-7-4-10-29-17)18(26)24-25-20(28)22-12-13-5-2-1-3-6-13/h1-11H,12H2,(H,23,27)(H,24,26)(H2,22,25,28) |
| InChIKey | QPYGLNXISAVPPW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|