C13H8ClN2O3S2- — CID 6953019
4-chloro-3-(thiophene-2-carbonylcarbamothioylamino)benzoate (PubChem CID 6953019) has the molecular formula C13H8ClN2O3S2- and a molecular weight of 339.81 g/mol. Its IUPAC name is 4-chloro-3-(thiophene-2-carbonylcarbamothioylamino)benzoate.
| Compound Name | 4-chloro-3-(thiophene-2-carbonylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 6953019 |
| Molecular Formula | C13H8ClN2O3S2- |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 4-chloro-3-(thiophene-2-carbonylcarbamothioylamino)benzoate |
| SMILES | O=C([O-])c1ccc(Cl)c(NC(=S)NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C13H9ClN2O3S2/c14-8-4-3-7(12(18)19)6-9(8)15-13(20)16-11(17)10-2-1-5-21-10/h1-6H,(H,18,19)(H2,15,16,17,20)/p-1 |
| InChIKey | CCIRTJJHUMKINA-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|