C16H12ClN2O3S- — CID 6957360
4-chloro-3-[(2-phenylacetyl)carbamothioylamino]benzoate (PubChem CID 6957360) has the molecular formula C16H12ClN2O3S- and a molecular weight of 347.80 g/mol. Its IUPAC name is 4-chloro-3-[(2-phenylacetyl)carbamothioylamino]benzoate.
| Compound Name | 4-chloro-3-[(2-phenylacetyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6957360 |
| Molecular Formula | C16H12ClN2O3S- |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-chloro-3-[(2-phenylacetyl)carbamothioylamino]benzoate |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H13ClN2O3S/c17-12-7-6-11(15(21)22)9-13(12)18-16(23)19-14(20)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,21,22)(H2,18,19,20,23)/p-1 |
| InChIKey | CEEJCPBWVNSQAX-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|