C16H11Cl2N2O4S- — CID 7312837
4-chloro-3-[[2-(4-chlorophenoxy)acetyl]carbamothioylamino]benzoate (PubChem CID 7312837) has the molecular formula C16H11Cl2N2O4S- and a molecular weight of 398.25 g/mol. Its IUPAC name is 4-chloro-3-[[2-(4-chlorophenoxy)acetyl]carbamothioylamino]benzoate.
| Compound Name | 4-chloro-3-[[2-(4-chlorophenoxy)acetyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7312837 |
| Molecular Formula | C16H11Cl2N2O4S- |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 4-chloro-3-[[2-(4-chlorophenoxy)acetyl]carbamothioylamino]benzoate |
| SMILES | O=C(COc1ccc(Cl)cc1)NC(=S)Nc1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O4S/c17-10-2-4-11(5-3-10)24-8-14(21)20-16(25)19-13-7-9(15(22)23)1-6-12(13)18/h1-7H,8H2,(H,22,23)(H2,19,20,21,25)/p-1 |
| InChIKey | AEHIGVQOTQRMBK-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|