C13H14ClN2O3S- — CID 2364414
4-chloro-3-(3-methylbutanoylcarbamothioylamino)benzoate (PubChem CID 2364414) has the molecular formula C13H14ClN2O3S- and a molecular weight of 313.79 g/mol. Its IUPAC name is 4-chloro-3-(3-methylbutanoylcarbamothioylamino)benzoate.
| Compound Name | 4-chloro-3-(3-methylbutanoylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 2364414 |
| Molecular Formula | C13H14ClN2O3S- |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-chloro-3-(3-methylbutanoylcarbamothioylamino)benzoate |
| SMILES | CC(C)CC(=O)NC(=S)Nc1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O3S/c1-7(2)5-11(17)16-13(20)15-10-6-8(12(18)19)3-4-9(10)14/h3-4,6-7H,5H2,1-2H3,(H,18,19)(H2,15,16,17,20)/p-1 |
| InChIKey | UGSGQROMTBIHDB-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|