C12H15Cl2N3OS — CID 47102452
1-(2,4-dichlorophenyl)-3-(3-methylbutanoylamino)thiourea (PubChem CID 47102452) has the molecular formula C12H15Cl2N3OS and a molecular weight of 320.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(3-methylbutanoylamino)thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(3-methylbutanoylamino)thiourea |
|---|---|
| PubChem CID | 47102452 |
| Molecular Formula | C12H15Cl2N3OS |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(3-methylbutanoylamino)thiourea |
| SMILES | CC(C)CC(=O)NNC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N3OS/c1-7(2)5-11(18)16-17-12(19)15-10-4-3-8(13)6-9(10)14/h3-4,6-7H,5H2,1-2H3,(H,16,18)(H2,15,17,19) |
| InChIKey | SYAQQWOKXVVRLO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|