C8H8Cl2N2S — CID 3310564
1-(2,4-dichlorophenyl)-3-methylthiourea (PubChem CID 3310564) has the molecular formula C8H8Cl2N2S and a molecular weight of 235.14 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-methylthiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-methylthiourea |
|---|---|
| PubChem CID | 3310564 |
| Molecular Formula | C8H8Cl2N2S |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N2S/c1-11-8(13)12-7-3-2-5(9)4-6(7)10/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | DTKJSIGFJFXNFE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|