C13H19Cl2N3S — CID 4572948
1-(2,4-dichlorophenyl)-3-[2-(diethylamino)ethyl]thiourea (PubChem CID 4572948) has the molecular formula C13H19Cl2N3S and a molecular weight of 320.29 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[2-(diethylamino)ethyl]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[2-(diethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 4572948 |
| Molecular Formula | C13H19Cl2N3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[2-(diethylamino)ethyl]thiourea |
| SMILES | CCN(CC)CCNC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3S/c1-3-18(4-2)8-7-16-13(19)17-12-6-5-10(14)9-11(12)15/h5-6,9H,3-4,7-8H2,1-2H3,(H2,16,17,19) |
| InChIKey | ODCZEBHZTBBNDL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|