C27H30Cl3N7S3 — CID 102342442
1-[2-[bis[2-[(3-chlorophenyl)carbamothioylamino]ethyl]amino]ethyl]-3-(3-chlorophenyl)thiourea (PubChem CID 102342442) has the molecular formula C27H30Cl3N7S3 and a molecular weight of 655.15 g/mol. Its IUPAC name is 1-[2-[bis[2-[(3-chlorophenyl)carbamothioylamino]ethyl]amino]ethyl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[2-[bis[2-[(3-chlorophenyl)carbamothioylamino]ethyl]amino]ethyl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 102342442 |
| Molecular Formula | C27H30Cl3N7S3 |
| Molecular Weight | 655.15 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | 1-[2-[bis[2-[(3-chlorophenyl)carbamothioylamino]ethyl]amino]ethyl]-3-(3-chlorophenyl)thiourea |
| SMILES | S=C(NCCN(CCNC(=S)Nc1cccc(Cl)c1)CCNC(=S)Nc1cccc(Cl)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H30Cl3N7S3/c28-19-4-1-7-22(16-19)34-25(38)31-10-13-37(14-11-32-26(39)35-23-8-2-5-20(29)17-23)15-12-33-27(40)36-24-9-3-6-21(30)18-24/h1-9,16-18H,10-15H2,(H2,31,34,38)(H2,32,35,39)(H2,33,36,40) |
| InChIKey | LSIQPHMBFOSLSD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.15 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|