C9H11ClN2S — CID 872568
1-(3-chlorophenyl)-3-ethylthiourea (PubChem CID 872568) has the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-ethylthiourea.
| Compound Name | 1-(3-chlorophenyl)-3-ethylthiourea |
|---|---|
| PubChem CID | 872568 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H11ClN2S/c1-2-11-9(13)12-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H2,11,12,13) |
| InChIKey | LLYHIRZDLYSGHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|