C11H15ClN2S — CID 6992117
1-(5-chloro-2-methylphenyl)-3-propylthiourea (PubChem CID 6992117) has the molecular formula C11H15ClN2S and a molecular weight of 242.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-propylthiourea.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-propylthiourea |
|---|---|
| PubChem CID | 6992117 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.78 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C11H15ClN2S/c1-3-6-13-11(15)14-10-7-9(12)5-4-8(10)2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15) |
| InChIKey | YOXYULLTHVLPOE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|