C13H17ClN2OS — CID 19187754
N-[(5-chloro-2-methylphenyl)carbamothioyl]pentanamide (PubChem CID 19187754) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is N-[(5-chloro-2-methylphenyl)carbamothioyl]pentanamide.
| Compound Name | N-[(5-chloro-2-methylphenyl)carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 19187754 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[(5-chloro-2-methylphenyl)carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C13H17ClN2OS/c1-3-4-5-12(17)16-13(18)15-11-8-10(14)7-6-9(11)2/h6-8H,3-5H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | FHKMNBBOGLZZKZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|