C16H24N2OS — CID 54789192
N-[(2,4-dimethylphenyl)carbamothioyl]heptanamide (PubChem CID 54789192) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamothioyl]heptanamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamothioyl]heptanamide |
|---|---|
| PubChem CID | 54789192 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamothioyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C16H24N2OS/c1-4-5-6-7-8-15(19)18-16(20)17-14-10-9-12(2)11-13(14)3/h9-11H,4-8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | XPYNHRFZKGPTHT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|