C12H14Cl2N2OS — CID 4925626
N-[(2,4-dichlorophenyl)carbamothioyl]pentanamide (PubChem CID 4925626) has the molecular formula C12H14Cl2N2OS and a molecular weight of 305.23 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)carbamothioyl]pentanamide.
| Compound Name | N-[(2,4-dichlorophenyl)carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 4925626 |
| Molecular Formula | C12H14Cl2N2OS |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-[(2,4-dichlorophenyl)carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2OS/c1-2-3-4-11(17)16-12(18)15-10-6-5-8(13)7-9(10)14/h5-7H,2-4H2,1H3,(H2,15,16,17,18) |
| InChIKey | JHWRAGLZICCZER-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|