C10H12Cl2N2S — CID 2281624
1-(2,4-dichlorophenyl)-3-propylthiourea (PubChem CID 2281624) has the molecular formula C10H12Cl2N2S and a molecular weight of 263.19 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-propylthiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-propylthiourea |
|---|---|
| PubChem CID | 2281624 |
| Molecular Formula | C10H12Cl2N2S |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2S/c1-2-5-13-10(15)14-9-4-3-7(11)6-8(9)12/h3-4,6H,2,5H2,1H3,(H2,13,14,15) |
| InChIKey | YLYSFUUWZMSBLZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|