C20H33ClN4S2 — CID 20787837
1-[2-chloro-4-(hexylcarbamothioylamino)phenyl]-3-hexylthiourea (PubChem CID 20787837) has the molecular formula C20H33ClN4S2 and a molecular weight of 429.10 g/mol. Its IUPAC name is 1-[2-chloro-4-(hexylcarbamothioylamino)phenyl]-3-hexylthiourea.
| Compound Name | 1-[2-chloro-4-(hexylcarbamothioylamino)phenyl]-3-hexylthiourea |
|---|---|
| PubChem CID | 20787837 |
| Molecular Formula | C20H33ClN4S2 |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[2-chloro-4-(hexylcarbamothioylamino)phenyl]-3-hexylthiourea |
| SMILES | CCCCCCNC(=S)Nc1ccc(NC(=S)NCCCCCC)c(Cl)c1 |
| InChI | InChI=1S/C20H33ClN4S2/c1-3-5-7-9-13-22-19(26)24-16-11-12-18(17(21)15-16)25-20(27)23-14-10-8-6-4-2/h11-12,15H,3-10,13-14H2,1-2H3,(H2,22,24,26)(H2,23,25,27) |
| InChIKey | SPZXUTWPRBIAST-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|