C16H25ClN2S — CID 19651087
1-(2-chlorophenyl)-3-nonylthiourea (PubChem CID 19651087) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-nonylthiourea.
| Compound Name | 1-(2-chlorophenyl)-3-nonylthiourea |
|---|---|
| PubChem CID | 19651087 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(2-chlorophenyl)-3-nonylthiourea |
| SMILES | CCCCCCCCCNC(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H25ClN2S/c1-2-3-4-5-6-7-10-13-18-16(20)19-15-12-9-8-11-14(15)17/h8-9,11-12H,2-7,10,13H2,1H3,(H2,18,19,20) |
| InChIKey | GNXWNYHSRZLRKY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|