C19H32N2OS — CID 19651220
1-decyl-3-(2-ethoxyphenyl)thiourea (PubChem CID 19651220) has the molecular formula C19H32N2OS and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-decyl-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-decyl-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19651220 |
| Molecular Formula | C19H32N2OS |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-decyl-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCCCCCCCCCNC(=S)Nc1ccccc1OCC |
| InChI | InChI=1S/C19H32N2OS/c1-3-5-6-7-8-9-10-13-16-20-19(23)21-17-14-11-12-15-18(17)22-4-2/h11-12,14-15H,3-10,13,16H2,1-2H3,(H2,20,21,23) |
| InChIKey | SDOGULRMMQVWOH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|