C16H25N3O3 — CID 19766776
N-(6-aminohexyl)-N'-(2-ethoxyphenyl)oxamide (PubChem CID 19766776) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(6-aminohexyl)-N'-(2-ethoxyphenyl)oxamide.
| Compound Name | N-(6-aminohexyl)-N'-(2-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 19766776 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-(6-aminohexyl)-N'-(2-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)NCCCCCCN |
| InChI | InChI=1S/C16H25N3O3/c1-2-22-14-10-6-5-9-13(14)19-16(21)15(20)18-12-8-4-3-7-11-17/h5-6,9-10H,2-4,7-8,11-12,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | OKVQHJSFDLZEFK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|