About 2-ethoxy-N-nonylaniline
2-ethoxy-N-nonylaniline (PubChem CID 43129179) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-ethoxy-N-nonylaniline.
Molecular Properties
| Compound Name | 2-ethoxy-N-nonylaniline |
| PubChem CID | 43129179 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-ethoxy-N-nonylaniline |
| SMILES | CCCCCCCCCNc1ccccc1OCC |
| InChI | InChI=1S/C17H29NO/c1-3-5-6-7-8-9-12-15-18-16-13-10-11-14-17(16)19-4-2/h10-11,13-14,18H,3-9,12,15H2,1-2H3 |
| InChIKey | PXTKLGDRHRQZPP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-nonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-nonylaniline?
The IUPAC name of 2-ethoxy-N-nonylaniline (CID 43129179) is 2-ethoxy-N-nonylaniline.
What is the SMILES notation for 2-ethoxy-N-nonylaniline?
The canonical SMILES for 2-ethoxy-N-nonylaniline is CCCCCCCCCNc1ccccc1OCC.
What is the InChIKey of 2-ethoxy-N-nonylaniline?
The InChIKey is PXTKLGDRHRQZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO/c1-3-5-6-7-8-9-12-15-18-16-13-10-11-14-17(16)19-4-2/h10-11,13-14,18H,3-9,12,15H2,1-2H3.
What are the key properties of 2-ethoxy-N-nonylaniline?
2-ethoxy-N-nonylaniline has a molecular weight of 263.43 g/mol, XLogP of 5.25, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-nonylaniline is sourced from PubChem (CID 43129179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).