C16H24N2O3S — CID 3736151
pentyl 2-[(2-ethoxyphenyl)carbamothioylamino]acetate (PubChem CID 3736151) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is pentyl 2-[(2-ethoxyphenyl)carbamothioylamino]acetate.
| Compound Name | pentyl 2-[(2-ethoxyphenyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 3736151 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | pentyl 2-[(2-ethoxyphenyl)carbamothioylamino]acetate |
| SMILES | CCCCCOC(=O)CNC(=S)Nc1ccccc1OCC |
| InChI | InChI=1S/C16H24N2O3S/c1-3-5-8-11-21-15(19)12-17-16(22)18-13-9-6-7-10-14(13)20-4-2/h6-7,9-10H,3-5,8,11-12H2,1-2H3,(H2,17,18,22) |
| InChIKey | ULBPKNSJIMDVKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|