C16H23ClN2O4S — CID 3736152
pentyl 2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]acetate (PubChem CID 3736152) has the molecular formula C16H23ClN2O4S and a molecular weight of 374.89 g/mol. Its IUPAC name is pentyl 2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]acetate.
| Compound Name | pentyl 2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 3736152 |
| Molecular Formula | C16H23ClN2O4S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | pentyl 2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]acetate |
| SMILES | CCCCCOC(=O)CNC(=S)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C16H23ClN2O4S/c1-4-5-6-7-23-15(20)10-18-16(24)19-12-9-13(21-2)11(17)8-14(12)22-3/h8-9H,4-7,10H2,1-3H3,(H2,18,19,24) |
| InChIKey | XKDOVKMVGAKVFI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|