C19H33ClN2O4S — CID 143811386
ethane;ethyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate (PubChem CID 143811386) has the molecular formula C19H33ClN2O4S and a molecular weight of 421.00 g/mol. Its IUPAC name is ethane;ethyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate.
| Compound Name | ethane;ethyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 143811386 |
| Molecular Formula | C19H33ClN2O4S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | ethane;ethyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate |
| SMILES | CC.CC.CCOC(=O)CCCNC(=S)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C15H21ClN2O4S.2C2H6/c1-4-22-14(19)6-5-7-17-15(23)18-11-9-12(20-2)10(16)8-13(11)21-3;2*1-2/h8-9H,4-7H2,1-3H3,(H2,17,18,23);2*1-2H3 |
| InChIKey | DWHSUAUFHHLVME-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|