C23H30ClN3O6S2 — CID 5155237
methyl 6-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]-2-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 5155237) has the molecular formula C23H30ClN3O6S2 and a molecular weight of 544.10 g/mol. Its IUPAC name is methyl 6-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]-2-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | methyl 6-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]-2-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 5155237 |
| Molecular Formula | C23H30ClN3O6S2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | methyl 6-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]-2-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=S)Nc1cc(OC)c(Cl)cc1OC)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30ClN3O6S2/c1-15-8-10-16(11-9-15)35(29,30)27-18(22(28)33-4)7-5-6-12-25-23(34)26-19-14-20(31-2)17(24)13-21(19)32-3/h8-11,13-14,18,27H,5-7,12H2,1-4H3,(H2,25,26,34) |
| InChIKey | OOJDAWURMGWQQY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|