C21H24Cl3N3O5S — CID 3823342
methyl 2-[(4-methylphenyl)sulfonylamino]-6-[(2,4,5-trichlorophenyl)carbamoylamino]hexanoate (PubChem CID 3823342) has the molecular formula C21H24Cl3N3O5S and a molecular weight of 536.87 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfonylamino]-6-[(2,4,5-trichlorophenyl)carbamoylamino]hexanoate.
| Compound Name | methyl 2-[(4-methylphenyl)sulfonylamino]-6-[(2,4,5-trichlorophenyl)carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 3823342 |
| Molecular Formula | C21H24Cl3N3O5S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfonylamino]-6-[(2,4,5-trichlorophenyl)carbamoylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)Nc1cc(Cl)c(Cl)cc1Cl)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H24Cl3N3O5S/c1-13-6-8-14(9-7-13)33(30,31)27-18(20(28)32-2)5-3-4-10-25-21(29)26-19-12-16(23)15(22)11-17(19)24/h6-9,11-12,18,27H,3-5,10H2,1-2H3,(H2,25,26,29) |
| InChIKey | CHGWHKWZZILRCV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|