C14H21ClN2O3S — CID 4427
N-(7-amino-1-chloro-2-oxoheptan-3-yl)-4-methylbenzenesulfonamide (PubChem CID 4427) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-(7-amino-1-chloro-2-oxoheptan-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(7-amino-1-chloro-2-oxoheptan-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4427 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-(7-amino-1-chloro-2-oxoheptan-3-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCCN)C(=O)CCl)cc1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-11-5-7-12(8-6-11)21(19,20)17-13(14(18)10-15)4-2-3-9-16/h5-8,13,17H,2-4,9-10,16H2,1H3 |
| InChIKey | RDFCSSHDJSZMTQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|