C19H25ClN4O5S — CID 14082457
(2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]-N-(4-nitrophenyl)hexanamide;hydrochloride (PubChem CID 14082457) has the molecular formula C19H25ClN4O5S and a molecular weight of 456.95 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]-N-(4-nitrophenyl)hexanamide;hydrochloride.
| Compound Name | (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]-N-(4-nitrophenyl)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 14082457 |
| Molecular Formula | C19H25ClN4O5S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]-N-(4-nitrophenyl)hexanamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1.Cl |
| InChI | InChI=1S/C19H24N4O5S.ClH/c1-14-5-11-17(12-6-14)29(27,28)22-18(4-2-3-13-20)19(24)21-15-7-9-16(10-8-15)23(25)26;/h5-12,18,22H,2-4,13,20H2,1H3,(H,21,24);1H/t18-;/m0./s1 |
| InChIKey | GJOYCOZDGCKYSM-FERBBOLQSA-N |
| XLogP | 2.74 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|