C26H30N4O2 — CID 91424137
(2S)-6-amino-N-(4-methylphenyl)-2-[(4-phenylphenyl)carbamoylamino]hexanamide (PubChem CID 91424137) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2S)-6-amino-N-(4-methylphenyl)-2-[(4-phenylphenyl)carbamoylamino]hexanamide.
| Compound Name | (2S)-6-amino-N-(4-methylphenyl)-2-[(4-phenylphenyl)carbamoylamino]hexanamide |
|---|---|
| PubChem CID | 91424137 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (2S)-6-amino-N-(4-methylphenyl)-2-[(4-phenylphenyl)carbamoylamino]hexanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](CCCCN)NC(=O)Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O2/c1-19-10-14-22(15-11-19)28-25(31)24(9-5-6-18-27)30-26(32)29-23-16-12-21(13-17-23)20-7-3-2-4-8-20/h2-4,7-8,10-17,24H,5-6,9,18,27H2,1H3,(H,28,31)(H2,29,30,32)/t24-/m0/s1 |
| InChIKey | VWLDEVRVGLYHKI-DEOSSOPVSA-N |
| XLogP | 4.92 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|