C27H31N5O5 — CID 91129944
(2S)-6-amino-N-(4-methylphenyl)-2-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoylamino]hexanamide (PubChem CID 91129944) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is (2S)-6-amino-N-(4-methylphenyl)-2-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoylamino]hexanamide.
| Compound Name | (2S)-6-amino-N-(4-methylphenyl)-2-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoylamino]hexanamide |
|---|---|
| PubChem CID | 91129944 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (2S)-6-amino-N-(4-methylphenyl)-2-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoylamino]hexanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](CCCCN)NC(=O)Nc2ccc(OCc3cccc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C27H31N5O5/c1-19-8-10-21(11-9-19)29-26(33)25(7-2-3-16-28)31-27(34)30-22-12-14-24(15-13-22)37-18-20-5-4-6-23(17-20)32(35)36/h4-6,8-15,17,25H,2-3,7,16,18,28H2,1H3,(H,29,33)(H2,30,31,34)/t25-/m0/s1 |
| InChIKey | PGTZHRZFMMZFSA-VWLOTQADSA-N |
| XLogP | 4.74 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|