C21H15F2N3O5 — CID 3036753
2,6-difluoro-N-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoyl]benzamide (PubChem CID 3036753) has the molecular formula C21H15F2N3O5 and a molecular weight of 427.36 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 3036753 |
| Molecular Formula | C21H15F2N3O5 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2,6-difluoro-N-[[4-[(3-nitrophenyl)methoxy]phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H15F2N3O5/c22-17-5-2-6-18(23)19(17)20(27)25-21(28)24-14-7-9-16(10-8-14)31-12-13-3-1-4-15(11-13)26(29)30/h1-11H,12H2,(H2,24,25,27,28) |
| InChIKey | MTSMAMCJIKZOBK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|