C27H20F2N2O3 — CID 134113957
2,6-difluoro-N-[(3-phenyl-4-phenylmethoxyphenyl)carbamoyl]benzamide (PubChem CID 134113957) has the molecular formula C27H20F2N2O3 and a molecular weight of 458.46 g/mol. Its IUPAC name is 2,6-difluoro-N-[(3-phenyl-4-phenylmethoxyphenyl)carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[(3-phenyl-4-phenylmethoxyphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 134113957 |
| Molecular Formula | C27H20F2N2O3 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2,6-difluoro-N-[(3-phenyl-4-phenylmethoxyphenyl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(OCc2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H20F2N2O3/c28-22-12-7-13-23(29)25(22)26(32)31-27(33)30-20-14-15-24(34-17-18-8-3-1-4-9-18)21(16-20)19-10-5-2-6-11-19/h1-16H,17H2,(H2,30,31,32,33) |
| InChIKey | ZKFIWSICZQHSKI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |