C21H14F4N2O3 — CID 134097670
2,3,5,6-tetrafluoro-N-[(3-methoxy-4-phenylphenyl)carbamoyl]benzamide (PubChem CID 134097670) has the molecular formula C21H14F4N2O3 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(3-methoxy-4-phenylphenyl)carbamoyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(3-methoxy-4-phenylphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 134097670 |
| Molecular Formula | C21H14F4N2O3 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(3-methoxy-4-phenylphenyl)carbamoyl]benzamide |
| SMILES | COc1cc(NC(=O)NC(=O)c2c(F)c(F)cc(F)c2F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H14F4N2O3/c1-30-16-9-12(7-8-13(16)11-5-3-2-4-6-11)26-21(29)27-20(28)17-18(24)14(22)10-15(23)19(17)25/h2-10H,1H3,(H2,26,27,28,29) |
| InChIKey | RXLGGPYUZPTADL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|