C22H12F8N2O3 — CID 134111155
2,3,4,5,6-pentafluoro-N-[[3-methoxy-4-[2-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide (PubChem CID 134111155) has the molecular formula C22H12F8N2O3 and a molecular weight of 504.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[3-methoxy-4-[2-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[3-methoxy-4-[2-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 134111155 |
| Molecular Formula | C22H12F8N2O3 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[3-methoxy-4-[2-(trifluoromethyl)phenyl]phenyl]carbamoyl]benzamide |
| SMILES | COc1cc(NC(=O)NC(=O)c2c(F)c(F)c(F)c(F)c2F)ccc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H12F8N2O3/c1-35-13-8-9(6-7-11(13)10-4-2-3-5-12(10)22(28,29)30)31-21(34)32-20(33)14-15(23)17(25)19(27)18(26)16(14)24/h2-8H,1H3,(H2,31,32,33,34) |
| InChIKey | JLQMQJJGXZYBOC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|