C31H38F3N3O5S — CID 162560486
4-(tert-butylsulfamoyl)-3-methoxy-N-[3-[3-(2-methoxyethylamino)propyl]-4-[2-(trifluoromethyl)phenyl]phenyl]benzamide (PubChem CID 162560486) has the molecular formula C31H38F3N3O5S and a molecular weight of 621.72 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-3-methoxy-N-[3-[3-(2-methoxyethylamino)propyl]-4-[2-(trifluoromethyl)phenyl]phenyl]benzamide.
| Compound Name | 4-(tert-butylsulfamoyl)-3-methoxy-N-[3-[3-(2-methoxyethylamino)propyl]-4-[2-(trifluoromethyl)phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 162560486 |
| Molecular Formula | C31H38F3N3O5S |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-3-methoxy-N-[3-[3-(2-methoxyethylamino)propyl]-4-[2-(trifluoromethyl)phenyl]phenyl]benzamide |
| SMILES | COCCNCCCc1cc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)c(OC)c2)ccc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H38F3N3O5S/c1-30(2,3)37-43(39,40)28-15-12-22(20-27(28)42-5)29(38)36-23-13-14-24(21(19-23)9-8-16-35-17-18-41-4)25-10-6-7-11-26(25)31(32,33)34/h6-7,10-15,19-20,35,37H,8-9,16-18H2,1-5H3,(H,36,38) |
| InChIKey | QVJBPBSROSGITG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|