C18H18F4N2O4S — CID 28557870
N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methoxy-3-(propylsulfamoyl)benzamide (PubChem CID 28557870) has the molecular formula C18H18F4N2O4S and a molecular weight of 434.41 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methoxy-3-(propylsulfamoyl)benzamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methoxy-3-(propylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 28557870 |
| Molecular Formula | C18H18F4N2O4S |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-4-methoxy-3-(propylsulfamoyl)benzamide |
| SMILES | CCCNS(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(C(F)(F)F)c2)ccc1OC |
| InChI | InChI=1S/C18H18F4N2O4S/c1-3-8-23-29(26,27)16-9-11(4-7-15(16)28-2)17(25)24-12-5-6-14(19)13(10-12)18(20,21)22/h4-7,9-10,23H,3,8H2,1-2H3,(H,24,25) |
| InChIKey | KEKOPTNHZRVTAB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |