C19H23FN2O4S — CID 34227801
3-(tert-butylsulfamoyl)-N-(3-fluoro-4-methylphenyl)-4-methoxybenzamide (PubChem CID 34227801) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-(3-fluoro-4-methylphenyl)-4-methoxybenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-(3-fluoro-4-methylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 34227801 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-(3-fluoro-4-methylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)c(F)c2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H23FN2O4S/c1-12-6-8-14(11-15(12)20)21-18(23)13-7-9-16(26-5)17(10-13)27(24,25)22-19(2,3)4/h6-11,22H,1-5H3,(H,21,23) |
| InChIKey | QBCJPENVVJEQAK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |