C19H30N2O4S — CID 26516485
3-(tert-butylsulfamoyl)-N-cycloheptyl-4-methoxybenzamide (PubChem CID 26516485) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-cycloheptyl-4-methoxybenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-cycloheptyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 26516485 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-cycloheptyl-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCCCC2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H30N2O4S/c1-19(2,3)21-26(23,24)17-13-14(11-12-16(17)25-4)18(22)20-15-9-7-5-6-8-10-15/h11-13,15,21H,5-10H2,1-4H3,(H,20,22) |
| InChIKey | MGAREFQOQMDXSF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |