C23H37N3O5S — CID 55949490
3-(tert-butylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-4-methoxybenzamide (PubChem CID 55949490) has the molecular formula C23H37N3O5S and a molecular weight of 467.63 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-4-methoxybenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55949490 |
| Molecular Formula | C23H37N3O5S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-4-methoxybenzamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C23H37N3O5S/c1-7-16(8-2)22(28)26-13-11-18(12-14-26)24-21(27)17-9-10-19(31-6)20(15-17)32(29,30)25-23(3,4)5/h9-10,15-16,18,25H,7-8,11-14H2,1-6H3,(H,24,27) |
| InChIKey | BEKBNIBAMCMUHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |