C22H34ClN3O4S — CID 55950765
4-chloro-3-(diethylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide (PubChem CID 55950765) has the molecular formula C22H34ClN3O4S and a molecular weight of 472.05 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55950765 |
| Molecular Formula | C22H34ClN3O4S |
| Molecular Weight | 472.05 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(CC)CC)c2)CC1 |
| InChI | InChI=1S/C22H34ClN3O4S/c1-5-16(6-2)22(28)25-13-11-18(12-14-25)24-21(27)17-9-10-19(23)20(15-17)31(29,30)26(7-3)8-4/h9-10,15-16,18H,5-8,11-14H2,1-4H3,(H,24,27) |
| InChIKey | RRCHCUDKVYLHTQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.05 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |