C20H24ClN3O4S — CID 38202373
N-(2-benzamidoethyl)-4-chloro-3-(diethylsulfamoyl)benzamide (PubChem CID 38202373) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-4-chloro-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-(2-benzamidoethyl)-4-chloro-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 38202373 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-(2-benzamidoethyl)-4-chloro-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCCNC(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C20H24ClN3O4S/c1-3-24(4-2)29(27,28)18-14-16(10-11-17(18)21)20(26)23-13-12-22-19(25)15-8-6-5-7-9-15/h5-11,14H,3-4,12-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | RPGPOFJDUFVEEL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|