C22H30ClN3O3S — CID 4876896
4-chloro-3-(diethylsulfamoyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide (PubChem CID 4876896) has the molecular formula C22H30ClN3O3S and a molecular weight of 452.02 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 4876896 |
| Molecular Formula | C22H30ClN3O3S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-[2-(dimethylamino)-3-phenylpropyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCC(Cc2ccccc2)N(C)C)ccc1Cl |
| InChI | InChI=1S/C22H30ClN3O3S/c1-5-26(6-2)30(28,29)21-15-18(12-13-20(21)23)22(27)24-16-19(25(3)4)14-17-10-8-7-9-11-17/h7-13,15,19H,5-6,14,16H2,1-4H3,(H,24,27) |
| InChIKey | YPFWPFIZAORQKP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |