C18H21IN2O — CID 42907096
N-[2-(dimethylamino)-3-phenylpropyl]-3-iodobenzamide (PubChem CID 42907096) has the molecular formula C18H21IN2O and a molecular weight of 408.28 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-phenylpropyl]-3-iodobenzamide.
| Compound Name | N-[2-(dimethylamino)-3-phenylpropyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 42907096 |
| Molecular Formula | C18H21IN2O |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-[2-(dimethylamino)-3-phenylpropyl]-3-iodobenzamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(I)c1)Cc1ccccc1 |
| InChI | InChI=1S/C18H21IN2O/c1-21(2)17(11-14-7-4-3-5-8-14)13-20-18(22)15-9-6-10-16(19)12-15/h3-10,12,17H,11,13H2,1-2H3,(H,20,22) |
| InChIKey | CVYWFTVEPSYLII-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|