C27H32N2O4 — CID 55450378
N-[2-(dimethylamino)-3-phenylpropyl]-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 55450378) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-phenylpropyl]-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[2-(dimethylamino)-3-phenylpropyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 55450378 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[2-(dimethylamino)-3-phenylpropyl]-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(Cc2ccccc2)N(C)C)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O4/c1-29(2)23(15-20-11-7-5-8-12-20)18-28-27(30)22-16-24(31-3)26(25(17-22)32-4)33-19-21-13-9-6-10-14-21/h5-14,16-17,23H,15,18-19H2,1-4H3,(H,28,30) |
| InChIKey | IAUIMVNDRFRBTG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |