C24H33N3O4S — CID 27740220
3-(cyclopentylsulfamoyl)-N-[(2S)-2-(dimethylamino)-3-phenylpropyl]-4-methoxybenzamide (PubChem CID 27740220) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[(2S)-2-(dimethylamino)-3-phenylpropyl]-4-methoxybenzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[(2S)-2-(dimethylamino)-3-phenylpropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 27740220 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[(2S)-2-(dimethylamino)-3-phenylpropyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H](Cc2ccccc2)N(C)C)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H33N3O4S/c1-27(2)21(15-18-9-5-4-6-10-18)17-25-24(28)19-13-14-22(31-3)23(16-19)32(29,30)26-20-11-7-8-12-20/h4-6,9-10,13-14,16,20-21,26H,7-8,11-12,15,17H2,1-3H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | LJXQVJMMWLLIPI-NRFANRHFSA-N |
| XLogP | 2.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |