C22H28N2O5S — CID 27822020
3-(cyclopentylsulfamoyl)-4-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide (PubChem CID 27822020) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-4-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 27822020 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-4-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(C)CCOc2ccccc2)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H28N2O5S/c1-24(14-15-29-19-10-4-3-5-11-19)22(25)17-12-13-20(28-2)21(16-17)30(26,27)23-18-8-6-7-9-18/h3-5,10-13,16,18,23H,6-9,14-15H2,1-2H3 |
| InChIKey | OITIXXDJIUTPMO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |