C19H22N2O5 — CID 17431378
4-(2-amino-2-oxoethoxy)-3-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide (PubChem CID 17431378) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 17431378 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-methoxy-N-methyl-N-(2-phenoxyethyl)benzamide |
| SMILES | COc1cc(C(=O)N(C)CCOc2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H22N2O5/c1-21(10-11-25-15-6-4-3-5-7-15)19(23)14-8-9-16(17(12-14)24-2)26-13-18(20)22/h3-9,12H,10-11,13H2,1-2H3,(H2,20,22) |
| InChIKey | MMQACGAZLBYFCZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |